About N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine
N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine (PubChem CID 123232628) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine |
| PubChem CID | 123232628 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine |
| SMILES | C=CC(=C)/N=C/C=N/C |
| InChI | InChI=1S/C7H10N2/c1-4-7(2)9-6-5-8-3/h4-6H,1-2H2,3H3/b8-5+,9-6+ |
| InChIKey | UIOBNSZBQLPOMO-XVYDYJIPSA-N |
| XLogP | 1.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine?
The IUPAC name of N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine (CID 123232628) is N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine.
What is the SMILES notation for N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine?
The canonical SMILES for N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine is C=CC(=C)/N=C/C=N/C.
What is the InChIKey of N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine?
The InChIKey is UIOBNSZBQLPOMO-XVYDYJIPSA-N. The full InChI is InChI=1S/C7H10N2/c1-4-7(2)9-6-5-8-3/h4-6H,1-2H2,3H3/b8-5+,9-6+.
What are the key properties of N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine?
N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine has a molecular weight of 122.17 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-buta-1,3-dien-2-yl-N-methylethane-1,2-diimine is sourced from PubChem (CID 123232628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).