C28H39NO — CID 123232693
2-butan-2-yl-N-(3,3-dimethylbutan-2-yl)-5-[2-(7-ethylcyclohepta-1,3,5-trien-1-yl)ethynyl]hepta-2,4,6-trienamide (PubChem CID 123232693) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is 2-butan-2-yl-N-(3,3-dimethylbutan-2-yl)-5-[2-(7-ethylcyclohepta-1,3,5-trien-1-yl)ethynyl]hepta-2,4,6-trienamide.
| Compound Name | 2-butan-2-yl-N-(3,3-dimethylbutan-2-yl)-5-[2-(7-ethylcyclohepta-1,3,5-trien-1-yl)ethynyl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123232693 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 2-butan-2-yl-N-(3,3-dimethylbutan-2-yl)-5-[2-(7-ethylcyclohepta-1,3,5-trien-1-yl)ethynyl]hepta-2,4,6-trienamide |
| SMILES | C=CC(C#CC1=CC=CC=CC1CC)=CC=C(C(=O)NC(C)C(C)(C)C)C(C)CC |
| InChI | InChI=1S/C28H39NO/c1-9-21(4)26(27(30)29-22(5)28(6,7)8)20-18-23(10-2)17-19-25-16-14-12-13-15-24(25)11-3/h10,12-16,18,20-22,24H,2,9,11H2,1,3-8H3,(H,29,30) |
| InChIKey | KJWYABCVYAXVAL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|