C30H35BN3O6+ — CID 123232805
methyl N-[2-oxo-2-[2-[[4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-1-ium-1-ylidene]methyl]pyrrolidin-1-yl]-1-phenylethyl]carbamate (PubChem CID 123232805) has the molecular formula C30H35BN3O6+ and a molecular weight of 544.44 g/mol. Its IUPAC name is methyl N-[2-oxo-2-[2-[[4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-1-ium-1-ylidene]methyl]pyrrolidin-1-yl]-1-phenylethyl]carbamate.
| Compound Name | methyl N-[2-oxo-2-[2-[[4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-1-ium-1-ylidene]methyl]pyrrolidin-1-yl]-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 123232805 |
| Molecular Formula | C30H35BN3O6+ |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | methyl N-[2-oxo-2-[2-[[4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-1-ium-1-ylidene]methyl]pyrrolidin-1-yl]-1-phenylethyl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1/C=[N+]1\C=CC(=O)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21)c1ccccc1 |
| InChI | InChI=1S/C30H34BN3O6/c1-29(2)30(3,4)40-31(39-29)21-13-14-24-23(18-21)25(35)15-17-33(24)19-22-12-9-16-34(22)27(36)26(32-28(37)38-5)20-10-7-6-8-11-20/h6-8,10-11,13-15,17-19,22,26H,9,12,16H2,1-5H3/p+1/b33-19+ |
| InChIKey | PCPPQGRTTRKWGN-HNSNBQBZSA-O |
| XLogP | 3.50 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|