C16H26N2O — CID 123232853
2-ethenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)penta-2,4-dienamide (PubChem CID 123232853) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-ethenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)penta-2,4-dienamide.
| Compound Name | 2-ethenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 123232853 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-ethenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)penta-2,4-dienamide |
| SMILES | C=CC=C(C=C)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H26N2O/c1-7-9-12(8-2)14(19)17-13-10-15(3,4)18-16(5,6)11-13/h7-9,13,18H,1-2,10-11H2,3-6H3,(H,17,19) |
| InChIKey | BRRWKGUWZKLCRU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|