C18H27N2O10S3- — CID 123232885
3-[4-(2,2-dimethylbutanoyloxycarbonyl)phenoxy]sulfonylpropylsulfonyl-methylsulfonylazanide;methanimine (PubChem CID 123232885) has the molecular formula C18H27N2O10S3- and a molecular weight of 527.62 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylbutanoyloxycarbonyl)phenoxy]sulfonylpropylsulfonyl-methylsulfonylazanide;methanimine.
| Compound Name | 3-[4-(2,2-dimethylbutanoyloxycarbonyl)phenoxy]sulfonylpropylsulfonyl-methylsulfonylazanide;methanimine |
|---|---|
| PubChem CID | 123232885 |
| Molecular Formula | C18H27N2O10S3- |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 3-[4-(2,2-dimethylbutanoyloxycarbonyl)phenoxy]sulfonylpropylsulfonyl-methylsulfonylazanide;methanimine |
| SMILES | CCC(C)(C)C(=O)OC(=O)c1ccc(OS(=O)(=O)CCCS(=O)(=O)[N-]S(C)(=O)=O)cc1.[H]N=C |
| InChI | InChI=1S/C17H24NO10S3.CH3N/c1-5-17(2,3)16(20)27-15(19)13-7-9-14(10-8-13)28-31(25,26)12-6-11-30(23,24)18-29(4,21)22;1-2/h7-10H,5-6,11-12H2,1-4H3;2H,1H2/q-1; |
| InChIKey | PGWCGVUWJRGUPZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 192.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|