C21H18Cl2N4O2S — CID 123233231
3-[(5E)-5-but-2-enylidene-4-methylidene-1H-pyrrol-3-yl]-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]diazenyl]propanoic acid (PubChem CID 123233231) has the molecular formula C21H18Cl2N4O2S and a molecular weight of 461.37 g/mol. Its IUPAC name is 3-[(5E)-5-but-2-enylidene-4-methylidene-1H-pyrrol-3-yl]-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]diazenyl]propanoic acid.
| Compound Name | 3-[(5E)-5-but-2-enylidene-4-methylidene-1H-pyrrol-3-yl]-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]diazenyl]propanoic acid |
|---|---|
| PubChem CID | 123233231 |
| Molecular Formula | C21H18Cl2N4O2S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 3-[(5E)-5-but-2-enylidene-4-methylidene-1H-pyrrol-3-yl]-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]diazenyl]propanoic acid |
| SMILES | C=c1c(CC(/N=N/c2nc(-c3ccc(Cl)c(Cl)c3)cs2)C(=O)O)c[nH]/c1=C/C=CC |
| InChI | InChI=1S/C21H18Cl2N4O2S/c1-3-4-5-17-12(2)14(10-24-17)9-18(20(28)29)26-27-21-25-19(11-30-21)13-6-7-15(22)16(23)8-13/h3-8,10-11,18,24H,2,9H2,1H3,(H,28,29)/b4-3?,17-5+,27-26+ |
| InChIKey | ZGIRONQDCLDLOI-HWSLYMLSSA-N |
| XLogP | 4.99 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|