About 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene]
2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] (PubChem CID 123233296) has the molecular formula C17H15NO2S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene].
Molecular Properties
| Compound Name | 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] |
| PubChem CID | 123233296 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] |
| SMILES | COCC1=NC2(CS1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H15NO2S/c1-19-10-16-18-17(11-21-16)12-6-2-4-8-14(12)20-15-9-5-3-7-13(15)17/h2-9H,10-11H2,1H3 |
| InChIKey | ZITYHVPPTHJIMF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene]?
The IUPAC name of 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] (CID 123233296) is 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene].
What is the SMILES notation for 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene]?
The canonical SMILES for 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] is COCC1=NC2(CS1)c1ccccc1Oc1ccccc12.
What is the InChIKey of 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene]?
The InChIKey is ZITYHVPPTHJIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2S/c1-19-10-16-18-17(11-21-16)12-6-2-4-8-14(12)20-15-9-5-3-7-13(15)17/h2-9H,10-11H2,1H3.
What are the key properties of 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene]?
2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] has a molecular weight of 297.38 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)spiro[5H-1,3-thiazole-4,9'-xanthene] is sourced from PubChem (CID 123233296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).