C32H23F9N4O3S — CID 123233356
2-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-[(4-fluorophenyl)sulfonylmethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 123233356) has the molecular formula C32H23F9N4O3S and a molecular weight of 714.61 g/mol. Its IUPAC name is 2-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-[(4-fluorophenyl)sulfonylmethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-[(4-fluorophenyl)sulfonylmethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 123233356 |
| Molecular Formula | C32H23F9N4O3S |
| Molecular Weight | 714.61 g/mol |
| Exact Mass | 714.13 |
| IUPAC Name | 2-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-[(4-fluorophenyl)sulfonylmethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CCC(CS(=O)(=O)c3ccc(F)cc3)(c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)C2)nc1 |
| InChI | InChI=1S/C32H23F9N4O3S/c33-23-8-10-24(11-9-23)49(46,47)19-29(12-13-45(18-29)28-43-15-20(14-42)16-44-28)21-4-6-22(7-5-21)30(31(36,37)38,32(39,40)41)48-17-25-26(34)2-1-3-27(25)35/h1-11,15-16H,12-13,17-19H2 |
| InChIKey | OJGFSYRHCYJIPD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |