About cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium
cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium (PubChem CID 123233405) has the molecular formula C11H18N+
and a molecular weight of 164.27 g/mol. Its IUPAC name is cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium.
Molecular Properties
| Compound Name | cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium |
| PubChem CID | 123233405 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium |
| SMILES | C=[N+](C)CC1=CC=CCCCC1 |
| InChI | InChI=1S/C11H18N/c1-12(2)10-11-8-6-4-3-5-7-9-11/h4,6,8H,1,3,5,7,9-10H2,2H3/q+1 |
| InChIKey | FUQHMZJRSIRJOZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium?
The IUPAC name of cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium (CID 123233405) is cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium.
What is the SMILES notation for cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium?
The canonical SMILES for cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium is C=[N+](C)CC1=CC=CCCCC1.
What is the InChIKey of cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium?
The InChIKey is FUQHMZJRSIRJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N/c1-12(2)10-11-8-6-4-3-5-7-9-11/h4,6,8H,1,3,5,7,9-10H2,2H3/q+1.
What are the key properties of cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium?
cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium has a molecular weight of 164.27 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cycloocta-1,3-dien-1-ylmethyl-methyl-methylideneazanium is sourced from PubChem (CID 123233405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).