About 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene
4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene (PubChem CID 123233811) has the molecular formula C23H28O2Si
and a molecular weight of 364.56 g/mol. Its IUPAC name is 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene.
Molecular Properties
| Compound Name | 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene |
| PubChem CID | 123233811 |
| Molecular Formula | C23H28O2Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene |
| SMILES | CC(C)(C)c1ccc(C2=CC(c3ccc(C(C)(C)C)cc3)=[O+][SiH-]O2)cc1 |
| InChI | InChI=1S/C23H28O2Si/c1-22(2,3)18-11-7-16(8-12-18)20-15-21(25-26-24-20)17-9-13-19(14-10-17)23(4,5)6/h7-15,26H,1-6H3 |
| InChIKey | SMJXSIQGZBLRIT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene?
The IUPAC name of 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene (CID 123233811) is 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene.
What is the SMILES notation for 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene?
The canonical SMILES for 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene is CC(C)(C)c1ccc(C2=CC(c3ccc(C(C)(C)C)cc3)=[O+][SiH-]O2)cc1.
What is the InChIKey of 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene?
The InChIKey is SMJXSIQGZBLRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O2Si/c1-22(2,3)18-11-7-16(8-12-18)20-15-21(25-26-24-20)17-9-13-19(14-10-17)23(4,5)6/h7-15,26H,1-6H3.
What are the key properties of 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene?
4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene has a molecular weight of 364.56 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(4-tert-butylphenyl)-3-oxa-1-oxonia-2-silanidacyclohexa-4,6-diene is sourced from PubChem (CID 123233811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).