About ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate
ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate (PubChem CID 123233940) has the molecular formula C18H23F2NO3
and a molecular weight of 339.38 g/mol. Its IUPAC name is ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate |
| PubChem CID | 123233940 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CCN(C)[C@H](Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C18H23F2NO3/c1-3-24-18(23)11-17(22)12-7-8-21(2)13(9-12)10-14-15(19)5-4-6-16(14)20/h4-6,12-13H,3,7-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | ADTFCFRBCVNVBS-OLZOCXBDSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate?
The IUPAC name of ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate (CID 123233940) is ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate is CCOC(=O)CC(=O)[C@@H]1CCN(C)[C@H](Cc2c(F)cccc2F)C1.
What is the InChIKey of ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate?
The InChIKey is ADTFCFRBCVNVBS-OLZOCXBDSA-N. The full InChI is InChI=1S/C18H23F2NO3/c1-3-24-18(23)11-17(22)12-7-8-21(2)13(9-12)10-14-15(19)5-4-6-16(14)20/h4-6,12-13H,3,7-11H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate?
ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate has a molecular weight of 339.38 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2S,4R)-2-[(2,6-difluorophenyl)methyl]-1-methylpiperidin-4-yl]-3-oxopropanoate is sourced from PubChem (CID 123233940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).