About (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate
(2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate (PubChem CID 123233961) has the molecular formula C16H27NO6
and a molecular weight of 329.39 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate |
| PubChem CID | 123233961 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate |
| SMILES | COC(C)(C)CCOC(C)(C)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H27NO6/c1-15(2,21-5)10-11-22-16(3,4)9-8-14(20)23-17-12(18)6-7-13(17)19/h6-7,18-19H,8-11H2,1-5H3 |
| InChIKey | WRFSCAMOHOGFMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate (CID 123233961) is (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate is COC(C)(C)CCOC(C)(C)CCC(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The InChIKey is WRFSCAMOHOGFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO6/c1-15(2,21-5)10-11-22-16(3,4)9-8-14(20)23-17-12(18)6-7-13(17)19/h6-7,18-19H,8-11H2,1-5H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
(2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate has a molecular weight of 329.39 g/mol, XLogP of 2.24, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate is sourced from PubChem (CID 123233961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).