About 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine
5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine (PubChem CID 123234225) has the molecular formula C15H14F3N3
and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 123234225 |
| Molecular Formula | C15H14F3N3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine |
| SMILES | Cc1cccc2nc(N)c(C3C=CC=C(C(F)(F)F)C3)n12 |
| InChI | InChI=1S/C15H14F3N3/c1-9-4-2-7-12-20-14(19)13(21(9)12)10-5-3-6-11(8-10)15(16,17)18/h2-7,10H,8,19H2,1H3 |
| InChIKey | PORRMGVDDWBNTB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine?
The IUPAC name of 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine (CID 123234225) is 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine is Cc1cccc2nc(N)c(C3C=CC=C(C(F)(F)F)C3)n12.
What is the InChIKey of 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine?
The InChIKey is PORRMGVDDWBNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3N3/c1-9-4-2-7-12-20-14(19)13(21(9)12)10-5-3-6-11(8-10)15(16,17)18/h2-7,10H,8,19H2,1H3.
What are the key properties of 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine?
5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine has a molecular weight of 293.29 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]imidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 123234225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).