About 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione
3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione (PubChem CID 123234376) has the molecular formula C7H10NO3+
and a molecular weight of 156.16 g/mol. Its IUPAC name is 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione.
Molecular Properties
| Compound Name | 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione |
| PubChem CID | 123234376 |
| Molecular Formula | C7H10NO3+ |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione |
| SMILES | C[N+]1(C)CC(=O)C(=CO)C1=O |
| InChI | InChI=1S/C7H9NO3/c1-8(2)3-6(10)5(4-9)7(8)11/h4H,3H2,1-2H3/p+1 |
| InChIKey | GGXMGKRTMZIWNY-UHFFFAOYSA-O |
| XLogP | -0.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione?
The IUPAC name of 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione (CID 123234376) is 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione.
What is the SMILES notation for 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione?
The canonical SMILES for 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione is C[N+]1(C)CC(=O)C(=CO)C1=O.
What is the InChIKey of 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione?
The InChIKey is GGXMGKRTMZIWNY-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H9NO3/c1-8(2)3-6(10)5(4-9)7(8)11/h4H,3H2,1-2H3/p+1.
What are the key properties of 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione?
3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione has a molecular weight of 156.16 g/mol, XLogP of -0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethylidene)-1,1-dimethylpyrrolidin-1-ium-2,4-dione is sourced from PubChem (CID 123234376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).