C15H21BrFN3O2S — CID 123234383
3-(6-bromo-3-fluoro-2-pyridinyl)-6-butyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 123234383) has the molecular formula C15H21BrFN3O2S and a molecular weight of 406.32 g/mol. Its IUPAC name is 3-(6-bromo-3-fluoro-2-pyridinyl)-6-butyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | 3-(6-bromo-3-fluoro-2-pyridinyl)-6-butyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 123234383 |
| Molecular Formula | C15H21BrFN3O2S |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 3-(6-bromo-3-fluoro-2-pyridinyl)-6-butyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CCCCC1(C)C(N)=NC(C)(c2nc(Br)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C15H21BrFN3O2S/c1-4-5-8-15(3)13(18)20-14(2,9-23(15,21)22)12-10(17)6-7-11(16)19-12/h6-7H,4-5,8-9H2,1-3H3,(H2,18,20) |
| InChIKey | JDDPBKZUDKRUFG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|