About 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride
1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride (PubChem CID 123235140) has the molecular formula C7H4FNO
and a molecular weight of 137.11 g/mol. Its IUPAC name is 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride.
Molecular Properties
| Compound Name | 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride |
| PubChem CID | 123235140 |
| Molecular Formula | C7H4FNO |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride |
| SMILES | O=C(F)C1=NC=C=CC=C1 |
| InChI | InChI=1S/C7H4FNO/c8-7(10)6-4-2-1-3-5-9-6/h1-2,4-5H |
| InChIKey | QAWCNKVTABKLCU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride?
The IUPAC name of 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride (CID 123235140) is 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride.
What is the SMILES notation for 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride?
The canonical SMILES for 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride is O=C(F)C1=NC=C=CC=C1.
What is the InChIKey of 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride?
The InChIKey is QAWCNKVTABKLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO/c8-7(10)6-4-2-1-3-5-9-6/h1-2,4-5H.
What are the key properties of 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride?
1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride has a molecular weight of 137.11 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azacyclohepta-1,3,5,6-tetraene-2-carbonyl fluoride is sourced from PubChem (CID 123235140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).