C35H25N4+ — CID 123235167
20-hexa-1,3,5-trien-3-yl-4-pyridin-3-yl-1,4-diaza-20-azoniaheptacyclo[13.11.1.02,14.03,11.05,10.019,27.021,26]heptacosa-2(14),3(11),5,7,9,12,15,17,19,21,23,25-dodecaene (PubChem CID 123235167) has the molecular formula C35H25N4+ and a molecular weight of 501.61 g/mol. Its IUPAC name is 20-hexa-1,3,5-trien-3-yl-4-pyridin-3-yl-1,4-diaza-20-azoniaheptacyclo[13.11.1.02,14.03,11.05,10.019,27.021,26]heptacosa-2(14),3(11),5,7,9,12,15,17,19,21,23,25-dodecaene.
| Compound Name | 20-hexa-1,3,5-trien-3-yl-4-pyridin-3-yl-1,4-diaza-20-azoniaheptacyclo[13.11.1.02,14.03,11.05,10.019,27.021,26]heptacosa-2(14),3(11),5,7,9,12,15,17,19,21,23,25-dodecaene |
|---|---|
| PubChem CID | 123235167 |
| Molecular Formula | C35H25N4+ |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 20-hexa-1,3,5-trien-3-yl-4-pyridin-3-yl-1,4-diaza-20-azoniaheptacyclo[13.11.1.02,14.03,11.05,10.019,27.021,26]heptacosa-2(14),3(11),5,7,9,12,15,17,19,21,23,25-dodecaene |
| SMILES | C=CC=C(C=C)[N+]1=C2C=CC=C3c4ccc5c6ccccc6n(-c6cccnc6)c5c4N(c4ccccc41)C32 |
| InChI | InChI=1S/C35H25N4/c1-3-11-23(4-2)37-30-16-7-8-17-31(30)39-33-26(14-9-18-32(33)37)28-20-19-27-25-13-5-6-15-29(25)38(34(27)35(28)39)24-12-10-21-36-22-24/h3-22,33H,1-2H2/q+1 |
| InChIKey | XWZLQGJZUXBTIH-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 24.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|