About 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide
2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide (PubChem CID 123235562) has the molecular formula C23H20FNO2
and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide |
| PubChem CID | 123235562 |
| Molecular Formula | C23H20FNO2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)C1=C(c2ccc(F)cc2)OC2=CC(C)=C(c3ccccc3)CC21 |
| InChI | InChI=1S/C23H20FNO2/c1-14-12-20-19(13-18(14)15-6-4-3-5-7-15)21(23(26)25-2)22(27-20)16-8-10-17(24)11-9-16/h3-12,19H,13H2,1-2H3,(H,25,26) |
| InChIKey | AYRAZENDIKBWKD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide?
The IUPAC name of 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide (CID 123235562) is 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide.
What is the SMILES notation for 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide?
The canonical SMILES for 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide is CNC(=O)C1=C(c2ccc(F)cc2)OC2=CC(C)=C(c3ccccc3)CC21.
What is the InChIKey of 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide?
The InChIKey is AYRAZENDIKBWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO2/c1-14-12-20-19(13-18(14)15-6-4-3-5-7-15)21(23(26)25-2)22(27-20)16-8-10-17(24)11-9-16/h3-12,19H,13H2,1-2H3,(H,25,26).
What are the key properties of 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide?
2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide has a molecular weight of 361.42 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-N,6-dimethyl-5-phenyl-3a,4-dihydro-1-benzofuran-3-carboxamide is sourced from PubChem (CID 123235562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).