C20H27N3O6S2 — CID 123236702
[1-methyl-4-(3,3,4-trimethyl-1,1-dioxo-2H-1-benzothiophene-5-carbonyl)pyrazol-5-yl] 2-(ethylamino)ethanesulfonate (PubChem CID 123236702) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is [1-methyl-4-(3,3,4-trimethyl-1,1-dioxo-2H-1-benzothiophene-5-carbonyl)pyrazol-5-yl] 2-(ethylamino)ethanesulfonate.
| Compound Name | [1-methyl-4-(3,3,4-trimethyl-1,1-dioxo-2H-1-benzothiophene-5-carbonyl)pyrazol-5-yl] 2-(ethylamino)ethanesulfonate |
|---|---|
| PubChem CID | 123236702 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [1-methyl-4-(3,3,4-trimethyl-1,1-dioxo-2H-1-benzothiophene-5-carbonyl)pyrazol-5-yl] 2-(ethylamino)ethanesulfonate |
| SMILES | CCNCCS(=O)(=O)Oc1c(C(=O)c2ccc3c(c2C)C(C)(C)CS3(=O)=O)cnn1C |
| InChI | InChI=1S/C20H27N3O6S2/c1-6-21-9-10-31(27,28)29-19-15(11-22-23(19)5)18(24)14-7-8-16-17(13(14)2)20(3,4)12-30(16,25)26/h7-8,11,21H,6,9-10,12H2,1-5H3 |
| InChIKey | SJCRGRIKGNMYSM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|