C10H16FN — CID 123237214
6-fluoro-8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline (PubChem CID 123237214) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is 6-fluoro-8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline.
| Compound Name | 6-fluoro-8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline |
|---|---|
| PubChem CID | 123237214 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 6-fluoro-8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline |
| SMILES | C=C1CC(F)CC2CCCNC12 |
| InChI | InChI=1S/C10H16FN/c1-7-5-9(11)6-8-3-2-4-12-10(7)8/h8-10,12H,1-6H2 |
| InChIKey | CMGNJLHKQMRVKH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|