About N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine
N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine (PubChem CID 123237341) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine |
| PubChem CID | 123237341 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)CC1CC=C(C)CCC1C |
| InChI | InChI=1S/C15H29N/c1-5-6-11-16(4)12-15-10-8-13(2)7-9-14(15)3/h8,14-15H,5-7,9-12H2,1-4H3 |
| InChIKey | IZABCROTEBFNGI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine?
The IUPAC name of N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine (CID 123237341) is N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine.
What is the SMILES notation for N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine?
The canonical SMILES for N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine is CCCCN(C)CC1CC=C(C)CCC1C.
What is the InChIKey of N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine?
The InChIKey is IZABCROTEBFNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-5-6-11-16(4)12-15-10-8-13(2)7-9-14(15)3/h8,14-15H,5-7,9-12H2,1-4H3.
What are the key properties of N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine?
N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine has a molecular weight of 223.40 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,7-dimethylcyclohept-3-en-1-yl)methyl]-N-methylbutan-1-amine is sourced from PubChem (CID 123237341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).