C25H35FN+ — CID 123237775
4-butyl-8,9,14-triethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene (PubChem CID 123237775) has the molecular formula C25H35FN+ and a molecular weight of 368.56 g/mol. Its IUPAC name is 4-butyl-8,9,14-triethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene.
| Compound Name | 4-butyl-8,9,14-triethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 123237775 |
| Molecular Formula | C25H35FN+ |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 4-butyl-8,9,14-triethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene |
| SMILES | CCCCc1ccc2c(c1)-c1cccc([n+]1CC)C(CC)(CF)C2(C)CC |
| InChI | InChI=1S/C25H35FN/c1-6-10-12-19-15-16-21-20(17-19)22-13-11-14-23(27(22)9-4)25(8-3,18-26)24(21,5)7-2/h11,13-17H,6-10,12,18H2,1-5H3/q+1 |
| InChIKey | CFRWVWVTNXAUFA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|