About 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane
4,4-dimethyl-1,2-di(propan-2-yloxy)pentane (PubChem CID 123238488) has the molecular formula C13H28O2
and a molecular weight of 216.36 g/mol. Its IUPAC name is 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane.
Molecular Properties
| Compound Name | 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane |
| PubChem CID | 123238488 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane |
| SMILES | CC(C)OCC(CC(C)(C)C)OC(C)C |
| InChI | InChI=1S/C13H28O2/c1-10(2)14-9-12(15-11(3)4)8-13(5,6)7/h10-12H,8-9H2,1-7H3 |
| InChIKey | VIECEQGAKZLFCK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane?
The IUPAC name of 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane (CID 123238488) is 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane.
What is the SMILES notation for 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane?
The canonical SMILES for 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane is CC(C)OCC(CC(C)(C)C)OC(C)C.
What is the InChIKey of 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane?
The InChIKey is VIECEQGAKZLFCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2/c1-10(2)14-9-12(15-11(3)4)8-13(5,6)7/h10-12H,8-9H2,1-7H3.
What are the key properties of 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane?
4,4-dimethyl-1,2-di(propan-2-yloxy)pentane has a molecular weight of 216.36 g/mol, XLogP of 3.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1,2-di(propan-2-yloxy)pentane is sourced from PubChem (CID 123238488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).