About thiane-2,3-diimine
thiane-2,3-diimine (PubChem CID 123238597) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is thiane-2,3-diimine.
Molecular Properties
| Compound Name | thiane-2,3-diimine |
| PubChem CID | 123238597 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | thiane-2,3-diimine |
| SMILES | [H]/N=C1\SCCC\C1=N/[H] |
| InChI | InChI=1S/C5H8N2S/c6-4-2-1-3-8-5(4)7/h6-7H,1-3H2/b6-4+,7-5- |
| InChIKey | YXCURXWJDMULNB-GUBXDBFYSA-N |
| XLogP | 1.51 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze thiane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiane-2,3-diimine?
The IUPAC name of thiane-2,3-diimine (CID 123238597) is thiane-2,3-diimine.
What is the SMILES notation for thiane-2,3-diimine?
The canonical SMILES for thiane-2,3-diimine is [H]/N=C1\SCCC\C1=N/[H].
What is the InChIKey of thiane-2,3-diimine?
The InChIKey is YXCURXWJDMULNB-GUBXDBFYSA-N. The full InChI is InChI=1S/C5H8N2S/c6-4-2-1-3-8-5(4)7/h6-7H,1-3H2/b6-4+,7-5-.
What are the key properties of thiane-2,3-diimine?
thiane-2,3-diimine has a molecular weight of 128.20 g/mol, XLogP of 1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-2,3-diimine is sourced from PubChem (CID 123238597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).