About 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide
5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide (PubChem CID 123238714) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 123238714 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)N(C)C)ns1 |
| InChI | InChI=1S/C8H12N2O2S/c1-10(2)8(11)7-4-6(5-12-3)13-9-7/h4H,5H2,1-3H3 |
| InChIKey | UNXNHYGKJQEUOT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide?
The IUPAC name of 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide (CID 123238714) is 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide is COCc1cc(C(=O)N(C)C)ns1.
What is the InChIKey of 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide?
The InChIKey is UNXNHYGKJQEUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-10(2)8(11)7-4-6(5-12-3)13-9-7/h4H,5H2,1-3H3.
What are the key properties of 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide?
5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide has a molecular weight of 200.26 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-N,N-dimethyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 123238714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).