C34H34N4O5 — CID 123239360
methyl 3-[[cyclopropyl-[1-(2-morpholin-4-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 123239360) has the molecular formula C34H34N4O5 and a molecular weight of 578.67 g/mol. Its IUPAC name is methyl 3-[[cyclopropyl-[1-(2-morpholin-4-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[[cyclopropyl-[1-(2-morpholin-4-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 123239360 |
| Molecular Formula | C34H34N4O5 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | methyl 3-[[cyclopropyl-[1-(2-morpholin-4-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2=C(c1ccccc1)N(c1ccc2c(c1)CCN2C(=O)CN1CCOCC1)C1CC1 |
| InChI | InChI=1S/C34H34N4O5/c1-42-34(41)24-7-11-27-28(20-24)35-33(40)31(27)32(22-5-3-2-4-6-22)38(25-8-9-25)26-10-12-29-23(19-26)13-14-37(29)30(39)21-36-15-17-43-18-16-36/h2-7,10-12,19-20,25H,8-9,13-18,21H2,1H3,(H,35,40) |
| InChIKey | GVCZAGNXPPBLDP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|