C26H50ClN7O — CID 123239776
3,3-diamino-N-[4-(4-aminopiperidin-1-yl)piperidin-3-yl]-2-(4-butyl-8-chloro-4-methyl-2,3,5,6,7,8-hexahydroazonin-2-yl)propanamide (PubChem CID 123239776) has the molecular formula C26H50ClN7O and a molecular weight of 512.19 g/mol. Its IUPAC name is 3,3-diamino-N-[4-(4-aminopiperidin-1-yl)piperidin-3-yl]-2-(4-butyl-8-chloro-4-methyl-2,3,5,6,7,8-hexahydroazonin-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-(4-aminopiperidin-1-yl)piperidin-3-yl]-2-(4-butyl-8-chloro-4-methyl-2,3,5,6,7,8-hexahydroazonin-2-yl)propanamide |
|---|---|
| PubChem CID | 123239776 |
| Molecular Formula | C26H50ClN7O |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 511.38 |
| IUPAC Name | 3,3-diamino-N-[4-(4-aminopiperidin-1-yl)piperidin-3-yl]-2-(4-butyl-8-chloro-4-methyl-2,3,5,6,7,8-hexahydroazonin-2-yl)propanamide |
| SMILES | CCCCC1(C)CCCC(Cl)/C=N\C(C(C(=O)NC2CNCCC2N2CCC(N)CC2)C(N)N)C1 |
| InChI | InChI=1S/C26H50ClN7O/c1-3-4-10-26(2)11-5-6-18(27)16-32-20(15-26)23(24(29)30)25(35)33-21-17-31-12-7-22(21)34-13-8-19(28)9-14-34/h16,18-24,31H,3-15,17,28-30H2,1-2H3,(H,33,35)/b32-16- |
| InChIKey | VUQJYOPUESMMON-ZMGVVAQMSA-N |
| XLogP | 1.93 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|