About but-2-enedioyl dichloride
but-2-enedioyl dichloride (PubChem CID 12324) has the molecular formula C4H2Cl2O2
and a molecular weight of 152.96 g/mol. Its IUPAC name is but-2-enedioyl dichloride.
Molecular Properties
| Compound Name | but-2-enedioyl dichloride |
| PubChem CID | 12324 |
| Molecular Formula | C4H2Cl2O2 |
| Molecular Weight | 152.96 g/mol |
| Exact Mass | 151.94 |
| IUPAC Name | but-2-enedioyl dichloride |
| SMILES | O=C(Cl)C=CC(=O)Cl |
| InChI | InChI=1S/C4H2Cl2O2/c5-3(7)1-2-4(6)8/h1-2H |
| InChIKey | ZLYYJUJDFKGVKB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.96 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioyl dichloride?
The IUPAC name of but-2-enedioyl dichloride (CID 12324) is but-2-enedioyl dichloride.
What is the SMILES notation for but-2-enedioyl dichloride?
The canonical SMILES for but-2-enedioyl dichloride is O=C(Cl)C=CC(=O)Cl.
What is the InChIKey of but-2-enedioyl dichloride?
The InChIKey is ZLYYJUJDFKGVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl2O2/c5-3(7)1-2-4(6)8/h1-2H.
What are the key properties of but-2-enedioyl dichloride?
but-2-enedioyl dichloride has a molecular weight of 152.96 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioyl dichloride is sourced from PubChem (CID 12324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).