C13H20 — CID 123240466
11-methyltetracyclo[8.2.0.02,4.06,8]dodecane (PubChem CID 123240466) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 11-methyltetracyclo[8.2.0.02,4.06,8]dodecane.
| Compound Name | 11-methyltetracyclo[8.2.0.02,4.06,8]dodecane |
|---|---|
| PubChem CID | 123240466 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 11-methyltetracyclo[8.2.0.02,4.06,8]dodecane |
| SMILES | CC1CC2C1CC1CC1CC1CC12 |
| InChI | InChI=1S/C13H20/c1-7-2-13-11(7)5-9-3-8(9)4-10-6-12(10)13/h7-13H,2-6H2,1H3 |
| InChIKey | JEZGXEYAGGDXBB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |