C29H38N4O2 — CID 123240568
6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(2H-tetrazol-5-yl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol (PubChem CID 123240568) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(2H-tetrazol-5-yl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol.
| Compound Name | 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(2H-tetrazol-5-yl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol |
|---|---|
| PubChem CID | 123240568 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(2H-tetrazol-5-yl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol |
| SMILES | C=c1c(O)c(O)cc2c1=CC=C1C2(C)CCC2(C)C3CC(C)(c4nn[nH]n4)CCC3(C)CCC12C |
| InChI | InChI=1S/C29H38N4O2/c1-17-18-7-8-21-27(4,19(18)15-20(34)23(17)35)12-14-29(6)22-16-26(3,24-30-32-33-31-24)10-9-25(22,2)11-13-28(21,29)5/h7-8,15,22,34-35H,1,9-14,16H2,2-6H3,(H,30,31,32,33) |
| InChIKey | MCALKZPLNFAXTN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|