C18H10F6O4S — CID 123240717
3-[3,5-bis(trifluoromethyl)phenyl]-1,1,4-trioxo-2,3-dihydrothiochromene-2-carbaldehyde (PubChem CID 123240717) has the molecular formula C18H10F6O4S and a molecular weight of 436.33 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1,1,4-trioxo-2,3-dihydrothiochromene-2-carbaldehyde.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,1,4-trioxo-2,3-dihydrothiochromene-2-carbaldehyde |
|---|---|
| PubChem CID | 123240717 |
| Molecular Formula | C18H10F6O4S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,1,4-trioxo-2,3-dihydrothiochromene-2-carbaldehyde |
| SMILES | O=CC1C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H10F6O4S/c19-17(20,21)10-5-9(6-11(7-10)18(22,23)24)15-14(8-25)29(27,28)13-4-2-1-3-12(13)16(15)26/h1-8,14-15H |
| InChIKey | LILKIZZRLBAYQS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|