C28H35FN8O5 — CID 123240992
N-[9-(3-ethyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide (PubChem CID 123240992) has the molecular formula C28H35FN8O5 and a molecular weight of 582.64 g/mol. Its IUPAC name is N-[9-(3-ethyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[9-(3-ethyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 123240992 |
| Molecular Formula | C28H35FN8O5 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | N-[9-(3-ethyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide |
| SMILES | CCC1N=C(C23CCC(NC(=O)C(=O)N(C)C)(CC2)c2nc(C(=O)NCc4ccc(F)c(C)c4)c(O)c(=O)n2C3)NN1 |
| InChI | InChI=1S/C28H35FN8O5/c1-5-18-31-25(35-34-18)27-8-10-28(11-9-27,33-22(40)24(42)36(3)4)26-32-19(20(38)23(41)37(26)14-27)21(39)30-13-16-6-7-17(29)15(2)12-16/h6-7,12,18,34,38H,5,8-11,13-14H2,1-4H3,(H,30,39)(H,31,35)(H,33,40) |
| InChIKey | JJIIDTLSMVULDC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|