C18H21NO2 — CID 123241141
(2,2-dimethyl-3,5-diphenyl-1,3-oxazolidin-4-yl)methanol (PubChem CID 123241141) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2,2-dimethyl-3,5-diphenyl-1,3-oxazolidin-4-yl)methanol.
| Compound Name | (2,2-dimethyl-3,5-diphenyl-1,3-oxazolidin-4-yl)methanol |
|---|---|
| PubChem CID | 123241141 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2,2-dimethyl-3,5-diphenyl-1,3-oxazolidin-4-yl)methanol |
| SMILES | CC1(C)OC(c2ccccc2)C(CO)N1c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-18(2)19(15-11-7-4-8-12-15)16(13-20)17(21-18)14-9-5-3-6-10-14/h3-12,16-17,20H,13H2,1-2H3 |
| InChIKey | GFFVXIAZPBWWFS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |