About N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane
N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane (PubChem CID 123241224) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane.
Analyze N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane?
The IUPAC name of N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane (CID 123241224) is N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane.
What is the SMILES notation for N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane?
The canonical SMILES for N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane is CC.CNC1=C(C)CCNC1.
What is the InChIKey of N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane?
The InChIKey is XZWAAUCOQSHHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-6-3-4-9-5-7(6)8-2;1-2/h8-9H,3-5H2,1-2H3;1-2H3.
What are the key properties of N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane?
N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane has a molecular weight of 156.27 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-1,2,3,6-tetrahydropyridin-5-amine;ethane is sourced from PubChem (CID 123241224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).