C26H40O4 — CID 123241364
(3'R,8'S,11'S,12'S,16'S)-16'-methyl-15'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-ene] (PubChem CID 123241364) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (3'R,8'S,11'S,12'S,16'S)-16'-methyl-15'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-ene].
| Compound Name | (3'R,8'S,11'S,12'S,16'S)-16'-methyl-15'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-ene] |
|---|---|
| PubChem CID | 123241364 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (3'R,8'S,11'S,12'S,16'S)-16'-methyl-15'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-ene] |
| SMILES | CC1(C2CC[C@H]3[C@@H]4CC[C@H]5CC6(CC[C@@H]5CC4=CC[C@]23C)OCCCO6)OCCO1 |
| InChI | InChI=1S/C26H40O4/c1-24-10-8-19-16-18-9-11-26(29-12-3-13-30-26)17-20(18)4-5-21(19)22(24)6-7-23(24)25(2)27-14-15-28-25/h8,18,20-23H,3-7,9-17H2,1-2H3/t18-,20+,21-,22+,23?,24+/m1/s1 |
| InChIKey | PGWQCMJWAAXQFS-JCJGDHIGSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|