C36H61F3N2O — CID 123241389
[3-(1,2,3,4,5,5a,6,7,8,9-decahydroheptalen-1-yl)-4-methylcyclohexyl]-[[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol (PubChem CID 123241389) has the molecular formula C36H61F3N2O and a molecular weight of 594.89 g/mol. Its IUPAC name is [3-(1,2,3,4,5,5a,6,7,8,9-decahydroheptalen-1-yl)-4-methylcyclohexyl]-[[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol.
| Compound Name | [3-(1,2,3,4,5,5a,6,7,8,9-decahydroheptalen-1-yl)-4-methylcyclohexyl]-[[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
|---|---|
| PubChem CID | 123241389 |
| Molecular Formula | C36H61F3N2O |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.47 |
| IUPAC Name | [3-(1,2,3,4,5,5a,6,7,8,9-decahydroheptalen-1-yl)-4-methylcyclohexyl]-[[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
| SMILES | CNC1CCC(CCC2CCC(NC(O)C3CCC(C)C(C4CCCCC5CCCCC=C54)C3)CC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C36H61F3N2O/c1-24-12-16-28(22-33(24)32-11-7-6-9-26-8-4-3-5-10-31(26)32)35(42)41-30-21-18-27(34(23-30)36(37,38)39)17-13-25-14-19-29(40-2)20-15-25/h10,24-30,32-35,40-42H,3-9,11-23H2,1-2H3 |
| InChIKey | VFIUNSMVZFLGGY-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|