About 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine
1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine (PubChem CID 123241859) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine.
Molecular Properties
| Compound Name | 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine |
| PubChem CID | 123241859 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine |
| SMILES | C=CC=CC=C(CF)CN1CCCCC1 |
| InChI | InChI=1S/C13H20FN/c1-2-3-5-8-13(11-14)12-15-9-6-4-7-10-15/h2-3,5,8H,1,4,6-7,9-12H2 |
| InChIKey | JWKWIYXXJZXUDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine?
The IUPAC name of 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine (CID 123241859) is 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine.
What is the SMILES notation for 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine?
The canonical SMILES for 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine is C=CC=CC=C(CF)CN1CCCCC1.
What is the InChIKey of 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine?
The InChIKey is JWKWIYXXJZXUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FN/c1-2-3-5-8-13(11-14)12-15-9-6-4-7-10-15/h2-3,5,8H,1,4,6-7,9-12H2.
What are the key properties of 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine?
1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine has a molecular weight of 209.31 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(fluoromethyl)hepta-2,4,6-trienyl]piperidine is sourced from PubChem (CID 123241859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).