About 1,1-dicyclohexylethyl 2-iminopropanoate
1,1-dicyclohexylethyl 2-iminopropanoate (PubChem CID 123241890) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is 1,1-dicyclohexylethyl 2-iminopropanoate.
Molecular Properties
| Compound Name | 1,1-dicyclohexylethyl 2-iminopropanoate |
| PubChem CID | 123241890 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1,1-dicyclohexylethyl 2-iminopropanoate |
| SMILES | [H]/N=C(\C)C(=O)OC(C)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H29NO2/c1-13(18)16(19)20-17(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h14-15,18H,3-12H2,1-2H3/b18-13+ |
| InChIKey | HVVHJWSBOOUJIX-QGOAFFKASA-N |
| XLogP | 4.49 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclohexylethyl 2-iminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexylethyl 2-iminopropanoate?
The IUPAC name of 1,1-dicyclohexylethyl 2-iminopropanoate (CID 123241890) is 1,1-dicyclohexylethyl 2-iminopropanoate.
What is the SMILES notation for 1,1-dicyclohexylethyl 2-iminopropanoate?
The canonical SMILES for 1,1-dicyclohexylethyl 2-iminopropanoate is [H]/N=C(\C)C(=O)OC(C)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,1-dicyclohexylethyl 2-iminopropanoate?
The InChIKey is HVVHJWSBOOUJIX-QGOAFFKASA-N. The full InChI is InChI=1S/C17H29NO2/c1-13(18)16(19)20-17(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h14-15,18H,3-12H2,1-2H3/b18-13+.
What are the key properties of 1,1-dicyclohexylethyl 2-iminopropanoate?
1,1-dicyclohexylethyl 2-iminopropanoate has a molecular weight of 279.42 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexylethyl 2-iminopropanoate is sourced from PubChem (CID 123241890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).