C24H31FN2O — CID 123241964
3-(4-fluoro-7-methylcyclohepta-2,4-dien-1-yl)-7-methyl-2-pentyl-8,9-dihydrocycloocta[d]pyrimidin-4-one (PubChem CID 123241964) has the molecular formula C24H31FN2O and a molecular weight of 382.52 g/mol. Its IUPAC name is 3-(4-fluoro-7-methylcyclohepta-2,4-dien-1-yl)-7-methyl-2-pentyl-8,9-dihydrocycloocta[d]pyrimidin-4-one.
| Compound Name | 3-(4-fluoro-7-methylcyclohepta-2,4-dien-1-yl)-7-methyl-2-pentyl-8,9-dihydrocycloocta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 123241964 |
| Molecular Formula | C24H31FN2O |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-(4-fluoro-7-methylcyclohepta-2,4-dien-1-yl)-7-methyl-2-pentyl-8,9-dihydrocycloocta[d]pyrimidin-4-one |
| SMILES | CCCCCc1nc2c(c(=O)n1C1C=CC(F)=CCC1C)=CC=C(C)CCC=2 |
| InChI | InChI=1S/C24H31FN2O/c1-4-5-6-10-23-26-21-9-7-8-17(2)11-15-20(21)24(28)27(23)22-16-14-19(25)13-12-18(22)3/h9,11,13-16,18,22H,4-8,10,12H2,1-3H3 |
| InChIKey | QYVKHZPQNLVQDH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|