C23H37NO4 — CID 123242026
6-methoxyimino-10,13-dimethyl-17-propan-2-yl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 123242026) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 6-methoxyimino-10,13-dimethyl-17-propan-2-yl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | 6-methoxyimino-10,13-dimethyl-17-propan-2-yl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 123242026 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 6-methoxyimino-10,13-dimethyl-17-propan-2-yl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CON=C1C=C2C(CCC3(C)C(C(C)C)CCC23O)C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C23H37NO4/c1-13(2)14-7-9-23(27)16-10-18(24-28-5)17-11-19(25)20(26)12-21(17,3)15(16)6-8-22(14,23)4/h10,13-15,17,19-20,25-27H,6-9,11-12H2,1-5H3 |
| InChIKey | NPEAINSETODLSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|