C24H48 — CID 123242157
6-ethenyl-2,5,7,8,10-pentamethylheptadecane (PubChem CID 123242157) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 6-ethenyl-2,5,7,8,10-pentamethylheptadecane.
| Compound Name | 6-ethenyl-2,5,7,8,10-pentamethylheptadecane |
|---|---|
| PubChem CID | 123242157 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 6-ethenyl-2,5,7,8,10-pentamethylheptadecane |
| SMILES | C=CC(C(C)CCC(C)C)C(C)C(C)CC(C)CCCCCCC |
| InChI | InChI=1S/C24H48/c1-9-11-12-13-14-15-20(5)18-22(7)23(8)24(10-2)21(6)17-16-19(3)4/h10,19-24H,2,9,11-18H2,1,3-8H3 |
| InChIKey | RHVIUTWBXFFYQY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|