C22H25ClN6O — CID 123242169
[5-[[3-(azetidin-1-ylmethyl)-5-chlorophenyl]methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-(methylamino)methanol (PubChem CID 123242169) has the molecular formula C22H25ClN6O and a molecular weight of 424.94 g/mol. Its IUPAC name is [5-[[3-(azetidin-1-ylmethyl)-5-chlorophenyl]methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-(methylamino)methanol.
| Compound Name | [5-[[3-(azetidin-1-ylmethyl)-5-chlorophenyl]methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 123242169 |
| Molecular Formula | C22H25ClN6O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [5-[[3-(azetidin-1-ylmethyl)-5-chlorophenyl]methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-(methylamino)methanol |
| SMILES | CNC(O)c1cc2c(ccc3nnc(C)n32)n1Cc1cc(Cl)cc(CN2CCC2)c1 |
| InChI | InChI=1S/C22H25ClN6O/c1-14-25-26-21-5-4-18-19(29(14)21)11-20(22(30)24-2)28(18)13-16-8-15(9-17(23)10-16)12-27-6-3-7-27/h4-5,8-11,22,24,30H,3,6-7,12-13H2,1-2H3 |
| InChIKey | JPIFTWLHZGHDHL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|