C15H26F3N3O2 — CID 123242256
5-[1-[2-(dimethylamino)ethyl-ethylamino]-2,2,2-trifluoroethyl]-1,2-dimethylpiperidine-3,4-dione (PubChem CID 123242256) has the molecular formula C15H26F3N3O2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-[1-[2-(dimethylamino)ethyl-ethylamino]-2,2,2-trifluoroethyl]-1,2-dimethylpiperidine-3,4-dione.
| Compound Name | 5-[1-[2-(dimethylamino)ethyl-ethylamino]-2,2,2-trifluoroethyl]-1,2-dimethylpiperidine-3,4-dione |
|---|---|
| PubChem CID | 123242256 |
| Molecular Formula | C15H26F3N3O2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-[1-[2-(dimethylamino)ethyl-ethylamino]-2,2,2-trifluoroethyl]-1,2-dimethylpiperidine-3,4-dione |
| SMILES | CCN(CCN(C)C)C(C1CN(C)C(C)C(=O)C1=O)C(F)(F)F |
| InChI | InChI=1S/C15H26F3N3O2/c1-6-21(8-7-19(3)4)14(15(16,17)18)11-9-20(5)10(2)12(22)13(11)23/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | LREBUOWBHPUICD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|