About oxan-3-yl(phenyl)silane
oxan-3-yl(phenyl)silane (PubChem CID 123242413) has the molecular formula C11H16OSi
and a molecular weight of 192.33 g/mol. Its IUPAC name is oxan-3-yl(phenyl)silane.
Molecular Properties
| Compound Name | oxan-3-yl(phenyl)silane |
| PubChem CID | 123242413 |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | oxan-3-yl(phenyl)silane |
| SMILES | c1ccc([SiH2]C2CCCOC2)cc1 |
| InChI | InChI=1S/C11H16OSi/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h1-3,5-6,11H,4,7-9,13H2 |
| InChIKey | BCHOYUDNCLPQPD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxan-3-yl(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-3-yl(phenyl)silane?
The IUPAC name of oxan-3-yl(phenyl)silane (CID 123242413) is oxan-3-yl(phenyl)silane.
What is the SMILES notation for oxan-3-yl(phenyl)silane?
The canonical SMILES for oxan-3-yl(phenyl)silane is c1ccc([SiH2]C2CCCOC2)cc1.
What is the InChIKey of oxan-3-yl(phenyl)silane?
The InChIKey is BCHOYUDNCLPQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16OSi/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h1-3,5-6,11H,4,7-9,13H2.
What are the key properties of oxan-3-yl(phenyl)silane?
oxan-3-yl(phenyl)silane has a molecular weight of 192.33 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-3-yl(phenyl)silane is sourced from PubChem (CID 123242413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).