C17H31N3O4 — CID 123242449
6-cyanatohexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate (PubChem CID 123242449) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is 6-cyanatohexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate.
| Compound Name | 6-cyanatohexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 123242449 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 6-cyanatohexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCCCCCOC#N)CC(C)(C)N1O |
| InChI | InChI=1S/C17H31N3O4/c1-16(2)11-14(12-17(3,4)20(16)22)19-15(21)24-10-8-6-5-7-9-23-13-18/h14,22H,5-12H2,1-4H3,(H,19,21) |
| InChIKey | YHWOWNPJCLRUER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|