C15H30O — CID 123242670
4-ethyl-5,5,7,7-tetramethylnonan-2-one (PubChem CID 123242670) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 4-ethyl-5,5,7,7-tetramethylnonan-2-one.
| Compound Name | 4-ethyl-5,5,7,7-tetramethylnonan-2-one |
|---|---|
| PubChem CID | 123242670 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 4-ethyl-5,5,7,7-tetramethylnonan-2-one |
| SMILES | CCC(CC(C)=O)C(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C15H30O/c1-8-13(10-12(3)16)15(6,7)11-14(4,5)9-2/h13H,8-11H2,1-7H3 |
| InChIKey | LTHDTDUBULDMKU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |