C9H14F3NO — CID 123242738
N-(2,2-dimethylbut-3-enyl)-3,3,3-trifluoropropanamide (PubChem CID 123242738) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is N-(2,2-dimethylbut-3-enyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(2,2-dimethylbut-3-enyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 123242738 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-(2,2-dimethylbut-3-enyl)-3,3,3-trifluoropropanamide |
| SMILES | C=CC(C)(C)CNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c1-4-8(2,3)6-13-7(14)5-9(10,11)12/h4H,1,5-6H2,2-3H3,(H,13,14) |
| InChIKey | VRQOFLXVGLLKIT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|