C16H13N5O — CID 123242900
5-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]pyridin-3-ol (PubChem CID 123242900) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]pyridin-3-ol.
| Compound Name | 5-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]pyridin-3-ol |
|---|---|
| PubChem CID | 123242900 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]pyridin-3-ol |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cncc(O)c3)nc21 |
| InChI | InChI=1S/C16H13N5O/c1-21-14-4-5-17-9-13(14)12-2-3-15(20-16(12)21)19-10-6-11(22)8-18-7-10/h2-9,22H,1H3,(H,19,20) |
| InChIKey | NAKCZWOOPFBFLL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |