C23H21N3O3 — CID 123242961
4-[(1S,2R,6S,7R,8S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrimidine-5-carbonitrile (PubChem CID 123242961) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[(1S,2R,6S,7R,8S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(1S,2R,6S,7R,8S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 123242961 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-[(1S,2R,6S,7R,8S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(C)c(C2C(=O)[C@@H]3[C@@H]4O[C@@H](C[C@H]4c4ncncc4C#N)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C23H21N3O3/c1-10-4-11(2)16(12(3)5-10)18-21(27)17-15-6-14(23(29-15)19(17)22(18)28)20-13(7-24)8-25-9-26-20/h4-5,8-9,14-15,17-19,23H,6H2,1-3H3/t14-,15-,17-,18?,19+,23+/m0/s1 |
| InChIKey | PLRFATGBQGZHEF-GQJHZOIMSA-N |
| XLogP | 2.70 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|