C33H53NO3 — CID 123243129
2-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-2,4,4,7-tetramethylnonan-5-one (PubChem CID 123243129) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is 2-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-2,4,4,7-tetramethylnonan-5-one.
| Compound Name | 2-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-2,4,4,7-tetramethylnonan-5-one |
|---|---|
| PubChem CID | 123243129 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | 2-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-2,4,4,7-tetramethylnonan-5-one |
| SMILES | CCCCCC(CCC)Cc1cc(O)n(-c2ccc(C(C)(C)CC(C)(C)C(=O)CC(C)CC)cc2)c1O |
| InChI | InChI=1S/C33H53NO3/c1-9-12-13-15-25(14-10-2)21-26-22-30(36)34(31(26)37)28-18-16-27(17-19-28)32(5,6)23-33(7,8)29(35)20-24(4)11-3/h16-19,22,24-25,36-37H,9-15,20-21,23H2,1-8H3 |
| InChIKey | BXNFKBQONRZFAY-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|